C23H28N4O9 — CID 158075626
1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione;2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methoxy]ethyl benzoate (PubChem CID 158075626) has the molecular formula C23H28N4O9 and a molecular weight of 504.50 g/mol. Its IUPAC name is 1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione;2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methoxy]ethyl benzoate.
| Compound Name | 1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione;2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methoxy]ethyl benzoate |
|---|---|
| PubChem CID | 158075626 |
| Molecular Formula | C23H28N4O9 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione;2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methoxy]ethyl benzoate |
| SMILES | Cc1cn(COCCO)c(=O)[nH]c1=O.Cc1cn(COCCOC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O5.C8H12N2O4/c1-11-9-17(15(20)16-13(11)18)10-21-7-8-22-14(19)12-5-3-2-4-6-12;1-6-4-10(5-14-3-2-11)8(13)9-7(6)12/h2-6,9H,7-8,10H2,1H3,(H,16,18,20);4,11H,2-3,5H2,1H3,(H,9,12,13) |
| InChIKey | FMIIFWQCQQSEFF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|