C14H15FN2O4 — CID 10447145
5-[(2-fluorophenyl)methyl]-1-(2-hydroxyethoxymethyl)pyrimidine-2,4-dione (PubChem CID 10447145) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-1-(2-hydroxyethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(2-fluorophenyl)methyl]-1-(2-hydroxyethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10447145 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-1-(2-hydroxyethoxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(COCCO)cc1Cc1ccccc1F |
| InChI | InChI=1S/C14H15FN2O4/c15-12-4-2-1-3-10(12)7-11-8-17(9-21-6-5-18)14(20)16-13(11)19/h1-4,8,18H,5-7,9H2,(H,16,19,20) |
| InChIKey | AITXWLIGNARBHU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|