C11H19FN2O3Si — CID 14515753
5-fluoro-1-(3-trimethylsilylpropoxymethyl)pyrimidine-2,4-dione (PubChem CID 14515753) has the molecular formula C11H19FN2O3Si and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-fluoro-1-(3-trimethylsilylpropoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(3-trimethylsilylpropoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14515753 |
| Molecular Formula | C11H19FN2O3Si |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-fluoro-1-(3-trimethylsilylpropoxymethyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCCOCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19FN2O3Si/c1-18(2,3)6-4-5-17-8-14-7-9(12)10(15)13-11(14)16/h7H,4-6,8H2,1-3H3,(H,13,15,16) |
| InChIKey | VWFAYQBRJBGICY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|