C13H22ClFN2O3Si — CID 70202013
3-(3-chloropropyl)-5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione (PubChem CID 70202013) has the molecular formula C13H22ClFN2O3Si and a molecular weight of 336.87 g/mol. Its IUPAC name is 3-(3-chloropropyl)-5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-chloropropyl)-5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70202013 |
| Molecular Formula | C13H22ClFN2O3Si |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-(3-chloropropyl)-5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCn1cc(F)c(=O)n(CCCCl)c1=O |
| InChI | InChI=1S/C13H22ClFN2O3Si/c1-21(2,3)8-7-20-10-16-9-11(15)12(18)17(13(16)19)6-4-5-14/h9H,4-8,10H2,1-3H3 |
| InChIKey | WVEWCLJQNQUAQD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|