C10H19BrN2O2Si — CID 166524443
4-bromo-2-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-one (PubChem CID 166524443) has the molecular formula C10H19BrN2O2Si and a molecular weight of 307.26 g/mol. Its IUPAC name is 4-bromo-2-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-one.
| Compound Name | 4-bromo-2-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 166524443 |
| Molecular Formula | C10H19BrN2O2Si |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-bromo-2-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-one |
| SMILES | Cn1c(=O)c(Br)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C10H19BrN2O2Si/c1-12-10(14)9(11)7-13(12)8-15-5-6-16(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | CDIOBHOUUORXNW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|