C16H24BrN3O4Si — CID 165392709
ethyl 2-[3-bromo-4-oxo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]acetate (PubChem CID 165392709) has the molecular formula C16H24BrN3O4Si and a molecular weight of 430.38 g/mol. Its IUPAC name is ethyl 2-[3-bromo-4-oxo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-bromo-4-oxo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 165392709 |
| Molecular Formula | C16H24BrN3O4Si |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | ethyl 2-[3-bromo-4-oxo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(Br)c2c(=O)n(COCC[Si](C)(C)C)ncc21 |
| InChI | InChI=1S/C16H24BrN3O4Si/c1-5-24-14(21)10-19-9-12(17)15-13(19)8-18-20(16(15)22)11-23-6-7-25(2,3)4/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | NREIMTNHYPLMMG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|