C20H36IN3O3Si2 — CID 66602918
3-ethyl-2-iodo-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602918) has the molecular formula C20H36IN3O3Si2 and a molecular weight of 549.60 g/mol. Its IUPAC name is 3-ethyl-2-iodo-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-ethyl-2-iodo-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602918 |
| Molecular Formula | C20H36IN3O3Si2 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 3-ethyl-2-iodo-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CCc1c(I)n(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C20H36IN3O3Si2/c1-8-16-18-17(23(19(16)21)14-26-9-11-28(2,3)4)13-22-24(20(18)25)15-27-10-12-29(5,6)7/h13H,8-12,14-15H2,1-7H3 |
| InChIKey | LHLJMIHMXOEGRH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|