C22H29N3O4Si — CID 167442811
1-(2-phenylmethoxyethyl)-6-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyridazine-2,5-dione (PubChem CID 167442811) has the molecular formula C22H29N3O4Si and a molecular weight of 427.58 g/mol. Its IUPAC name is 1-(2-phenylmethoxyethyl)-6-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyridazine-2,5-dione.
| Compound Name | 1-(2-phenylmethoxyethyl)-6-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyridazine-2,5-dione |
|---|---|
| PubChem CID | 167442811 |
| Molecular Formula | C22H29N3O4Si |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-(2-phenylmethoxyethyl)-6-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyridazine-2,5-dione |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(ccc(=O)n2CCOCc2ccccc2)c1=O |
| InChI | InChI=1S/C22H29N3O4Si/c1-30(2,3)14-13-29-17-25-22(27)19-9-10-21(26)24(20(19)15-23-25)11-12-28-16-18-7-5-4-6-8-18/h4-10,15H,11-14,16-17H2,1-3H3 |
| InChIKey | KXIYSMAGQIYUFH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|