C17H26N2O3Si — CID 170983030
5-(1-hydroxypropan-2-yl)-2-(2-trimethylsilylethoxymethyl)phthalazin-1-one (PubChem CID 170983030) has the molecular formula C17H26N2O3Si and a molecular weight of 334.49 g/mol. Its IUPAC name is 5-(1-hydroxypropan-2-yl)-2-(2-trimethylsilylethoxymethyl)phthalazin-1-one.
| Compound Name | 5-(1-hydroxypropan-2-yl)-2-(2-trimethylsilylethoxymethyl)phthalazin-1-one |
|---|---|
| PubChem CID | 170983030 |
| Molecular Formula | C17H26N2O3Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5-(1-hydroxypropan-2-yl)-2-(2-trimethylsilylethoxymethyl)phthalazin-1-one |
| SMILES | CC(CO)c1cccc2c(=O)n(COCC[Si](C)(C)C)ncc12 |
| InChI | InChI=1S/C17H26N2O3Si/c1-13(11-20)14-6-5-7-15-16(14)10-18-19(17(15)21)12-22-8-9-23(2,3)4/h5-7,10,13,20H,8-9,11-12H2,1-4H3 |
| InChIKey | HJEKXGZJVJSDBI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|