C15H23FN2O3Si — CID 165175424
(1R)-1-[7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]ethane-1,2-diol (PubChem CID 165175424) has the molecular formula C15H23FN2O3Si and a molecular weight of 326.44 g/mol. Its IUPAC name is (1R)-1-[7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 165175424 |
| Molecular Formula | C15H23FN2O3Si |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1R)-1-[7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]ethane-1,2-diol |
| SMILES | C[Si](C)(C)CCOCn1ncc2c([C@@H](O)CO)ccc(F)c21 |
| InChI | InChI=1S/C15H23FN2O3Si/c1-22(2,3)7-6-21-10-18-15-12(8-17-18)11(14(20)9-19)4-5-13(15)16/h4-5,8,14,19-20H,6-7,9-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | AGPFXLYCSONVPC-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|