C23H26F2N4O2Si — CID 86679800
5-(2,2-difluoroethyl)-7-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]quinolin-4-one (PubChem CID 86679800) has the molecular formula C23H26F2N4O2Si and a molecular weight of 456.57 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-7-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]quinolin-4-one.
| Compound Name | 5-(2,2-difluoroethyl)-7-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 86679800 |
| Molecular Formula | C23H26F2N4O2Si |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-(2,2-difluoroethyl)-7-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]quinolin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(=O)n(CC(F)F)c3cc(-c4ccncc4)ccc3c21 |
| InChI | InChI=1S/C23H26F2N4O2Si/c1-32(2,3)11-10-31-15-29-22-18-5-4-17(16-6-8-26-9-7-16)12-20(18)28(14-21(24)25)23(30)19(22)13-27-29/h4-9,12-13,21H,10-11,14-15H2,1-3H3 |
| InChIKey | OOBGMDYTPOUDLZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|