C15H21FN2O2Si — CID 165175428
2-[[7-fluoro-4-[(2R)-oxiran-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 165175428) has the molecular formula C15H21FN2O2Si and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[[7-fluoro-4-[(2R)-oxiran-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-fluoro-4-[(2R)-oxiran-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 165175428 |
| Molecular Formula | C15H21FN2O2Si |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[[7-fluoro-4-[(2R)-oxiran-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c([C@@H]3CO3)ccc(F)c21 |
| InChI | InChI=1S/C15H21FN2O2Si/c1-21(2,3)7-6-19-10-18-15-12(8-17-18)11(14-9-20-14)4-5-13(15)16/h4-5,8,14H,6-7,9-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | YMZAMRYZRSJTPI-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 39.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|