C14H25N3OSi — CID 162342097
trimethyl-[2-(4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-ylmethoxy)ethyl]silane (PubChem CID 162342097) has the molecular formula C14H25N3OSi and a molecular weight of 279.46 g/mol. Its IUPAC name is trimethyl-[2-(4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-ylmethoxy)ethyl]silane.
| Compound Name | trimethyl-[2-(4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-ylmethoxy)ethyl]silane |
|---|---|
| PubChem CID | 162342097 |
| Molecular Formula | C14H25N3OSi |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | trimethyl-[2-(4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-ylmethoxy)ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1CC1CCC2N1 |
| InChI | InChI=1S/C14H25N3OSi/c1-19(2,3)7-6-18-10-17-14-8-11-4-5-13(16-11)12(14)9-15-17/h9,11,13,16H,4-8,10H2,1-3H3 |
| InChIKey | KMGUIKKVHLJNDT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|