C11H18ClN3OSi — CID 171832869
2-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]acetonitrile (PubChem CID 171832869) has the molecular formula C11H18ClN3OSi and a molecular weight of 271.82 g/mol. Its IUPAC name is 2-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]acetonitrile.
| Compound Name | 2-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 171832869 |
| Molecular Formula | C11H18ClN3OSi |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ncc(Cl)c1CC#N |
| InChI | InChI=1S/C11H18ClN3OSi/c1-17(2,3)7-6-16-9-15-11(4-5-13)10(12)8-14-15/h8H,4,6-7,9H2,1-3H3 |
| InChIKey | QDUIEWGRXSGVAG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|