C15H23ClN4OSi — CID 171757792
5-(2-amino-5-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine (PubChem CID 171757792) has the molecular formula C15H23ClN4OSi and a molecular weight of 338.92 g/mol. Its IUPAC name is 5-(2-amino-5-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine.
| Compound Name | 5-(2-amino-5-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 171757792 |
| Molecular Formula | C15H23ClN4OSi |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-(2-amino-5-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ncc(N)c1-c1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H23ClN4OSi/c1-22(2,3)7-6-21-10-20-15(14(18)9-19-20)12-8-11(16)4-5-13(12)17/h4-5,8-9H,6-7,10,17-18H2,1-3H3 |
| InChIKey | CDUNBDPWCJYBFT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|