C17H25ClN4O3Si — CID 171630161
methyl 4-amino-3-[4-amino-3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]benzoate (PubChem CID 171630161) has the molecular formula C17H25ClN4O3Si and a molecular weight of 396.95 g/mol. Its IUPAC name is methyl 4-amino-3-[4-amino-3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]benzoate.
| Compound Name | methyl 4-amino-3-[4-amino-3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 171630161 |
| Molecular Formula | C17H25ClN4O3Si |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 4-amino-3-[4-amino-3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(N)c(-c2c(N)c(Cl)nn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H25ClN4O3Si/c1-24-17(23)11-5-6-13(19)12(9-11)15-14(20)16(18)21-22(15)10-25-7-8-26(2,3)4/h5-6,9H,7-8,10,19-20H2,1-4H3 |
| InChIKey | XQSPZUOKHVDTQS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|