C18H23ClN2O4Si — CID 162361540
methyl 4-(2-chloropyrimidin-4-yl)-3-(2-trimethylsilylethoxymethoxy)benzoate (PubChem CID 162361540) has the molecular formula C18H23ClN2O4Si and a molecular weight of 394.93 g/mol. Its IUPAC name is methyl 4-(2-chloropyrimidin-4-yl)-3-(2-trimethylsilylethoxymethoxy)benzoate.
| Compound Name | methyl 4-(2-chloropyrimidin-4-yl)-3-(2-trimethylsilylethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 162361540 |
| Molecular Formula | C18H23ClN2O4Si |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl 4-(2-chloropyrimidin-4-yl)-3-(2-trimethylsilylethoxymethoxy)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccnc(Cl)n2)c(OCOCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H23ClN2O4Si/c1-23-17(22)13-5-6-14(15-7-8-20-18(19)21-15)16(11-13)25-12-24-9-10-26(2,3)4/h5-8,11H,9-10,12H2,1-4H3 |
| InChIKey | UTYCSNGAFPVSJP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|