C18H23BrO4Si — CID 21023517
methyl 8-bromo-4-(2-trimethylsilylethoxymethoxy)naphthalene-2-carboxylate (PubChem CID 21023517) has the molecular formula C18H23BrO4Si and a molecular weight of 411.37 g/mol. Its IUPAC name is methyl 8-bromo-4-(2-trimethylsilylethoxymethoxy)naphthalene-2-carboxylate.
| Compound Name | methyl 8-bromo-4-(2-trimethylsilylethoxymethoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 21023517 |
| Molecular Formula | C18H23BrO4Si |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 8-bromo-4-(2-trimethylsilylethoxymethoxy)naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(OCOCC[Si](C)(C)C)c2cccc(Br)c2c1 |
| InChI | InChI=1S/C18H23BrO4Si/c1-21-18(20)13-10-15-14(6-5-7-16(15)19)17(11-13)23-12-22-8-9-24(2,3)4/h5-7,10-11H,8-9,12H2,1-4H3 |
| InChIKey | VZOCPHQIEHNXME-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|