C24H24BrF2N3O3Si — CID 67494639
methyl 3-bromo-5-(2,6-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinoline-7-carboxylate (PubChem CID 67494639) has the molecular formula C24H24BrF2N3O3Si and a molecular weight of 548.46 g/mol. Its IUPAC name is methyl 3-bromo-5-(2,6-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinoline-7-carboxylate.
| Compound Name | methyl 3-bromo-5-(2,6-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 67494639 |
| Molecular Formula | C24H24BrF2N3O3Si |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | methyl 3-bromo-5-(2,6-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(-c1c(F)cccc1F)nc1c(Br)nn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C24H24BrF2N3O3Si/c1-32-24(31)14-8-9-15-16(12-14)20(19-17(26)6-5-7-18(19)27)28-21-22(15)30(29-23(21)25)13-33-10-11-34(2,3)4/h5-9,12H,10-11,13H2,1-4H3 |
| InChIKey | DXFKXCSSEDKFLY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|