C17H22BrN5O3Si — CID 168945823
methyl 6-[[3-bromo-4-cyano-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]pyridine-3-carboxylate (PubChem CID 168945823) has the molecular formula C17H22BrN5O3Si and a molecular weight of 452.39 g/mol. Its IUPAC name is methyl 6-[[3-bromo-4-cyano-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-bromo-4-cyano-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168945823 |
| Molecular Formula | C17H22BrN5O3Si |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | methyl 6-[[3-bromo-4-cyano-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2c(C#N)c(Br)nn2COCC[Si](C)(C)C)nc1 |
| InChI | InChI=1S/C17H22BrN5O3Si/c1-25-17(24)12-5-6-14(20-10-12)21-16-13(9-19)15(18)22-23(16)11-26-7-8-27(2,3)4/h5-6,10H,7-8,11H2,1-4H3,(H,20,21) |
| InChIKey | MTHVWSZBBCTIRQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|