C15H21BrN2O3Si — CID 166173802
methyl 4-bromo-2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylate (PubChem CID 166173802) has the molecular formula C15H21BrN2O3Si and a molecular weight of 385.33 g/mol. Its IUPAC name is methyl 4-bromo-2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylate.
| Compound Name | methyl 4-bromo-2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylate |
|---|---|
| PubChem CID | 166173802 |
| Molecular Formula | C15H21BrN2O3Si |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | methyl 4-bromo-2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylate |
| SMILES | COC(=O)c1ccc(Br)c2cn(COCC[Si](C)(C)C)nc12 |
| InChI | InChI=1S/C15H21BrN2O3Si/c1-20-15(19)11-5-6-13(16)12-9-18(17-14(11)12)10-21-7-8-22(2,3)4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | ULIJHCFBHTUQJZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|