C17H25Br2N3O3SSi — CID 172588307
3-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide (PubChem CID 172588307) has the molecular formula C17H25Br2N3O3SSi and a molecular weight of 539.37 g/mol. Its IUPAC name is 3-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide.
| Compound Name | 3-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 172588307 |
| Molecular Formula | C17H25Br2N3O3SSi |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 536.98 |
| IUPAC Name | 3-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1cn(COCC[Si](C)(C)C)nc1Cc1scc(Br)c1Br |
| InChI | InChI=1S/C17H25Br2N3O3SSi/c1-21(24-2)17(23)12-9-22(11-25-6-7-27(3,4)5)20-14(12)8-15-16(19)13(18)10-26-15/h9-10H,6-8,11H2,1-5H3 |
| InChIKey | NZFZCRZRCRBIFD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|