C11H11Br2N3O2S — CID 172588206
5-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1H-pyrazole-4-carboxamide (PubChem CID 172588206) has the molecular formula C11H11Br2N3O2S and a molecular weight of 409.10 g/mol. Its IUPAC name is 5-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 172588206 |
| Molecular Formula | C11H11Br2N3O2S |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 406.89 |
| IUPAC Name | 5-[(3,4-dibromothiophen-2-yl)methyl]-N-methoxy-N-methyl-1H-pyrazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1cn[nH]c1Cc1scc(Br)c1Br |
| InChI | InChI=1S/C11H11Br2N3O2S/c1-16(18-2)11(17)6-4-14-15-8(6)3-9-10(13)7(12)5-19-9/h4-5H,3H2,1-2H3,(H,14,15) |
| InChIKey | PKXBJWBAOGAPKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|