C9H13NO2S — CID 10536001
N-methoxy-N,3,4-trimethylthiophene-2-carboxamide (PubChem CID 10536001) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is N-methoxy-N,3,4-trimethylthiophene-2-carboxamide.
| Compound Name | N-methoxy-N,3,4-trimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 10536001 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N-methoxy-N,3,4-trimethylthiophene-2-carboxamide |
| SMILES | CON(C)C(=O)c1scc(C)c1C |
| InChI | InChI=1S/C9H13NO2S/c1-6-5-13-8(7(6)2)9(11)10(3)12-4/h5H,1-4H3 |
| InChIKey | GXWRQDONNIBITP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|