C14H21NO2S — CID 143467174
N-methoxy-N,3,5,5-tetramethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide (PubChem CID 143467174) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-methoxy-N,3,5,5-tetramethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide.
| Compound Name | N-methoxy-N,3,5,5-tetramethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 143467174 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-methoxy-N,3,5,5-tetramethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide |
| SMILES | CON(C)C(=O)c1sc(C)c2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C14H21NO2S/c1-9-11-8-14(2,3)7-6-10(11)12(18-9)13(16)15(4)17-5/h6-8H2,1-5H3 |
| InChIKey | DFCQQKNJGDBOTL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|