C6H6Br2N2O2S — CID 164902665
2,4-dibromo-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide (PubChem CID 164902665) has the molecular formula C6H6Br2N2O2S and a molecular weight of 330.00 g/mol. Its IUPAC name is 2,4-dibromo-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dibromo-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164902665 |
| Molecular Formula | C6H6Br2N2O2S |
| Molecular Weight | 330.00 g/mol |
| Exact Mass | 327.85 |
| IUPAC Name | 2,4-dibromo-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1sc(Br)nc1Br |
| InChI | InChI=1S/C6H6Br2N2O2S/c1-10(12-2)5(11)3-4(7)9-6(8)13-3/h1-2H3 |
| InChIKey | BGOWXGYXSUJWBD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|