C6H7ClN2O3S — CID 130683669
4-chloro-N-methoxy-N-methyl-3-oxo-1,2-thiazole-5-carboxamide (PubChem CID 130683669) has the molecular formula C6H7ClN2O3S and a molecular weight of 222.65 g/mol. Its IUPAC name is 4-chloro-N-methoxy-N-methyl-3-oxo-1,2-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-methoxy-N-methyl-3-oxo-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130683669 |
| Molecular Formula | C6H7ClN2O3S |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 4-chloro-N-methoxy-N-methyl-3-oxo-1,2-thiazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1s[nH]c(=O)c1Cl |
| InChI | InChI=1S/C6H7ClN2O3S/c1-9(12-2)6(11)4-3(7)5(10)8-13-4/h1-2H3,(H,8,10) |
| InChIKey | NSFNJPZIJYMQNU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|