C6H6Cl2N2O2S — CID 59705066
4,5-dichloro-N-methoxy-N-methyl-1,2-thiazole-3-carboxamide (PubChem CID 59705066) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 4,5-dichloro-N-methoxy-N-methyl-1,2-thiazole-3-carboxamide.
| Compound Name | 4,5-dichloro-N-methoxy-N-methyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 59705066 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 4,5-dichloro-N-methoxy-N-methyl-1,2-thiazole-3-carboxamide |
| SMILES | CON(C)C(=O)c1nsc(Cl)c1Cl |
| InChI | InChI=1S/C6H6Cl2N2O2S/c1-10(12-2)6(11)4-3(7)5(8)13-9-4/h1-2H3 |
| InChIKey | QIDDDDYHDBJSOU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|