C13H18Cl2N2O4S — CID 7409280
[(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate (PubChem CID 7409280) has the molecular formula C13H18Cl2N2O4S and a molecular weight of 369.27 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7409280 |
| Molecular Formula | C13H18Cl2N2O4S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
| SMILES | COCCNC(=O)[C@H](CC(C)C)OC(=O)c1nsc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O4S/c1-7(2)6-8(12(18)16-4-5-20-3)21-13(19)10-9(14)11(15)22-17-10/h7-8H,4-6H2,1-3H3,(H,16,18)/t8-/m0/s1 |
| InChIKey | MBVMRRHFXNOJFU-QMMMGPOBSA-N |
| XLogP | 2.78 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|