C11H14Cl2N2O4S — CID 7409327
[(2R)-1-(2-methoxyethylamino)-1-oxobutan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate (PubChem CID 7409327) has the molecular formula C11H14Cl2N2O4S and a molecular weight of 341.22 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxobutan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxobutan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7409327 |
| Molecular Formula | C11H14Cl2N2O4S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxobutan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
| SMILES | CC[C@@H](OC(=O)c1nsc(Cl)c1Cl)C(=O)NCCOC |
| InChI | InChI=1S/C11H14Cl2N2O4S/c1-3-6(10(16)14-4-5-18-2)19-11(17)8-7(12)9(13)20-15-8/h6H,3-5H2,1-2H3,(H,14,16)/t6-/m1/s1 |
| InChIKey | DFTWKVXYZJNVSG-ZCFIWIBFSA-N |
| XLogP | 2.15 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|