C8H7Cl2N2NaO3S — CID 154722987
sodium 4-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]butanoate (PubChem CID 154722987) has the molecular formula C8H7Cl2N2NaO3S and a molecular weight of 305.12 g/mol. Its IUPAC name is sodium 4-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]butanoate.
| Compound Name | sodium 4-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 154722987 |
| Molecular Formula | C8H7Cl2N2NaO3S |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | sodium 4-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)c1nsc(Cl)c1Cl.[Na+] |
| InChI | InChI=1S/C8H8Cl2N2O3S.Na/c9-5-6(12-16-7(5)10)8(15)11-3-1-2-4(13)14;/h1-3H2,(H,11,15)(H,13,14);/q;+1/p-1 |
| InChIKey | KCEWRKYJZLWKKB-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|