C7H9ClN4O2S — CID 80624913
N-(4-amino-4-oxobutyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80624913) has the molecular formula C7H9ClN4O2S and a molecular weight of 248.69 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80624913 |
| Molecular Formula | C7H9ClN4O2S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide |
| SMILES | NC(=O)CCCNC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C7H9ClN4O2S/c8-7-12-11-6(15-7)5(14)10-3-1-2-4(9)13/h1-3H2,(H2,9,13)(H,10,14) |
| InChIKey | LYVAJUUFLSUQSU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|