C13H14ClN3OS — CID 80619556
5-chloro-N-(3-phenylbutyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80619556) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 5-chloro-N-(3-phenylbutyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-phenylbutyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80619556 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-chloro-N-(3-phenylbutyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(CCNC(=O)c1nnc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-9(10-5-3-2-4-6-10)7-8-15-11(18)12-16-17-13(14)19-12/h2-6,9H,7-8H2,1H3,(H,15,18) |
| InChIKey | OTVDPMKZFSCIPK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |