C6H8ClN3O2S — CID 80625182
5-chloro-N-(3-hydroxypropyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80625182) has the molecular formula C6H8ClN3O2S and a molecular weight of 221.67 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxypropyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-hydroxypropyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80625182 |
| Molecular Formula | C6H8ClN3O2S |
| Molecular Weight | 221.67 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | 5-chloro-N-(3-hydroxypropyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCCO)c1nnc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN3O2S/c7-6-10-9-5(13-6)4(12)8-2-1-3-11/h11H,1-3H2,(H,8,12) |
| InChIKey | BDCIIQNTNRHWQT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|