C8H8ClN3OS2 — CID 106427248
5-chloro-N-(2-prop-2-ynylsulfanylethyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 106427248) has the molecular formula C8H8ClN3OS2 and a molecular weight of 261.76 g/mol. Its IUPAC name is 5-chloro-N-(2-prop-2-ynylsulfanylethyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(2-prop-2-ynylsulfanylethyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 106427248 |
| Molecular Formula | C8H8ClN3OS2 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 5-chloro-N-(2-prop-2-ynylsulfanylethyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | C#CCSCCNC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C8H8ClN3OS2/c1-2-4-14-5-3-10-6(13)7-11-12-8(9)15-7/h1H,3-5H2,(H,10,13) |
| InChIKey | ZRHLRIRCYYGELW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|