C11H12LiNO4 — CID 142769153
lithium 4-[(4-hydroxybenzoyl)amino]butanoate (PubChem CID 142769153) has the molecular formula C11H12LiNO4 and a molecular weight of 229.16 g/mol. Its IUPAC name is lithium 4-[(4-hydroxybenzoyl)amino]butanoate.
| Compound Name | lithium 4-[(4-hydroxybenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 142769153 |
| Molecular Formula | C11H12LiNO4 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | lithium 4-[(4-hydroxybenzoyl)amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)c1ccc(O)cc1.[Li+] |
| InChI | InChI=1S/C11H13NO4.Li/c13-9-5-3-8(4-6-9)11(16)12-7-1-2-10(14)15;/h3-6,13H,1-2,7H2,(H,12,16)(H,14,15);/q;+1/p-1 |
| InChIKey | YODJCHBVXPOAIC-UHFFFAOYSA-M |
| XLogP | -3.34 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|