C20H34N2O4 — CID 175439207
ethyl(trimethyl)azanium;8-[(4-hydroxybenzoyl)amino]octanoate (PubChem CID 175439207) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;8-[(4-hydroxybenzoyl)amino]octanoate.
| Compound Name | ethyl(trimethyl)azanium;8-[(4-hydroxybenzoyl)amino]octanoate |
|---|---|
| PubChem CID | 175439207 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | ethyl(trimethyl)azanium;8-[(4-hydroxybenzoyl)amino]octanoate |
| SMILES | CC[N+](C)(C)C.O=C([O-])CCCCCCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H21NO4.C5H14N/c17-13-9-7-12(8-10-13)15(20)16-11-5-3-1-2-4-6-14(18)19;1-5-6(2,3)4/h7-10,17H,1-6,11H2,(H,16,20)(H,18,19);5H2,1-4H3/q;+1/p-1 |
| InChIKey | CVWBIHQHQUDEKE-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|