C27H39NO2 — CID 53394478
4-hydroxy-N-icosa-5,8,11,14-tetraenylbenzamide (PubChem CID 53394478) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is 4-hydroxy-N-icosa-5,8,11,14-tetraenylbenzamide.
| Compound Name | 4-hydroxy-N-icosa-5,8,11,14-tetraenylbenzamide |
|---|---|
| PubChem CID | 53394478 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | 4-hydroxy-N-icosa-5,8,11,14-tetraenylbenzamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-28-27(30)25-20-22-26(29)23-21-25/h6-7,9-10,12-13,15-16,20-23,29H,2-5,8,11,14,17-19,24H2,1H3,(H,28,30) |
| InChIKey | XCWBOAHOJHPWLA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|