C60H102N2O3 — CID 90399327
2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-N-[(9Z,12Z)-octadeca-9,12-dienyl]pyridine-4-carboxamide (PubChem CID 90399327) has the molecular formula C60H102N2O3 and a molecular weight of 899.49 g/mol. Its IUPAC name is 2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-N-[(9Z,12Z)-octadeca-9,12-dienyl]pyridine-4-carboxamide.
| Compound Name | 2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-N-[(9Z,12Z)-octadeca-9,12-dienyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90399327 |
| Molecular Formula | C60H102N2O3 |
| Molecular Weight | 899.49 g/mol |
| Exact Mass | 898.79 |
| IUPAC Name | 2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-N-[(9Z,12Z)-octadeca-9,12-dienyl]pyridine-4-carboxamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(=O)c1cc(OCCCCCCCC/C=C\C/C=C\CCCCC)nc(OCCCCCCCC/C=C\C/C=C\CCCCC)c1 |
| InChI | InChI=1S/C60H102N2O3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-61-60(63)57-55-58(64-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)62-59(56-57)65-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h16-21,25-30,55-56H,4-15,22-24,31-54H2,1-3H3,(H,61,63)/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChIKey | HKKFNHPFJQKJOO-BBWANDEASA-N |
| XLogP | 19.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.49 |
| LogP ≤ 5 | 19.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|