C44H76N2O2 — CID 86296864
1-[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]-N,N-dimethylmethanamine (PubChem CID 86296864) has the molecular formula C44H76N2O2 and a molecular weight of 665.10 g/mol. Its IUPAC name is 1-[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 86296864 |
| Molecular Formula | C44H76N2O2 |
| Molecular Weight | 665.10 g/mol |
| Exact Mass | 664.59 |
| IUPAC Name | 1-[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]-N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOc1cc(CN(C)C)cc(OCCCCCCCC/C=C\C/C=C\CCCCC)n1 |
| InChI | InChI=1S/C44H76N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-47-43-39-42(41-46(3)4)40-44(45-43)48-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39-40H,5-12,17-18,23-38,41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | XDKZBMBEQWLKTB-KWXKLSQISA-N |
| XLogP | 13.53 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.10 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|