C48H82N2O4 — CID 146337293
2-[[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]methyl]-4-(dimethylamino)butanoic acid (PubChem CID 146337293) has the molecular formula C48H82N2O4 and a molecular weight of 751.19 g/mol. Its IUPAC name is 2-[[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]methyl]-4-(dimethylamino)butanoic acid.
| Compound Name | 2-[[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]methyl]-4-(dimethylamino)butanoic acid |
|---|---|
| PubChem CID | 146337293 |
| Molecular Formula | C48H82N2O4 |
| Molecular Weight | 751.19 g/mol |
| Exact Mass | 750.63 |
| IUPAC Name | 2-[[2,6-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-4-pyridinyl]methyl]-4-(dimethylamino)butanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOc1cc(CC(CCN(C)C)C(=O)O)cc(OCCCCCCCC/C=C\C/C=C\CCCCC)n1 |
| InChI | InChI=1S/C48H82N2O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-53-46-42-44(41-45(48(51)52)37-38-50(3)4)43-47(49-46)54-40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-43,45H,5-12,17-18,23-41H2,1-4H3,(H,51,52)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | ZTVODGRMZANINO-KWXKLSQISA-N |
| XLogP | 13.66 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.19 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|