C46H90N3O3P — CID 169075524
N'-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phosphoryl-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 169075524) has the molecular formula C46H90N3O3P and a molecular weight of 764.22 g/mol. Its IUPAC name is N'-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phosphoryl-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phosphoryl-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 169075524 |
| Molecular Formula | C46H90N3O3P |
| Molecular Weight | 764.22 g/mol |
| Exact Mass | 763.67 |
| IUPAC Name | N'-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phosphoryl-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOP(=O)(OCCCCCCCC/C=C\C/C=C\CCCCC)N(CCCN(C)C)CCCN(C)C |
| InChI | InChI=1S/C46H90N3O3P/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45-51-53(50,49(43-39-41-47(3)4)44-40-42-48(5)6)52-46-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h15-18,21-24H,7-14,19-20,25-46H2,1-6H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | BZFHIHDYRFRVEN-MLLZQYMOSA-N |
| XLogP | 13.96 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.22 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|