C52H100N2O — CID 166839177
N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N,N-dimethyl-N'-(nonoxymethyl)propane-1,3-diamine (PubChem CID 166839177) has the molecular formula C52H100N2O and a molecular weight of 769.38 g/mol. Its IUPAC name is N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N,N-dimethyl-N'-(nonoxymethyl)propane-1,3-diamine.
| Compound Name | N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N,N-dimethyl-N'-(nonoxymethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 166839177 |
| Molecular Formula | C52H100N2O |
| Molecular Weight | 769.38 g/mol |
| Exact Mass | 768.78 |
| IUPAC Name | N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N,N-dimethyl-N'-(nonoxymethyl)propane-1,3-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(CCCN(C)C)COCCCCCCCCC |
| InChI | InChI=1S/C52H100N2O/c1-6-9-12-15-18-20-22-24-26-28-30-32-34-36-39-42-46-52(47-43-40-37-35-33-31-29-27-25-23-21-19-16-13-10-7-2)54(49-45-48-53(4)5)51-55-50-44-41-38-17-14-11-8-3/h18-21,24-27,52H,6-17,22-23,28-51H2,1-5H3/b20-18-,21-19-,26-24-,27-25- |
| InChIKey | XRDJOMCAODNAPQ-LKONLTQMSA-N |
| XLogP | 16.74 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.38 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|