C50H98N2 — CID 142339863
N'-(2-hexyldecyl)-N,N-dimethyl-N'-[(20Z,23Z)-nonacosa-1,20,23-trien-11-yl]propane-1,3-diamine (PubChem CID 142339863) has the molecular formula C50H98N2 and a molecular weight of 727.35 g/mol. Its IUPAC name is N'-(2-hexyldecyl)-N,N-dimethyl-N'-[(20Z,23Z)-nonacosa-1,20,23-trien-11-yl]propane-1,3-diamine.
| Compound Name | N'-(2-hexyldecyl)-N,N-dimethyl-N'-[(20Z,23Z)-nonacosa-1,20,23-trien-11-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 142339863 |
| Molecular Formula | C50H98N2 |
| Molecular Weight | 727.35 g/mol |
| Exact Mass | 726.77 |
| IUPAC Name | N'-(2-hexyldecyl)-N,N-dimethyl-N'-[(20Z,23Z)-nonacosa-1,20,23-trien-11-yl]propane-1,3-diamine |
| SMILES | C=CCCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(CCCN(C)C)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H98N2/c1-7-11-15-19-22-24-25-26-27-28-29-30-31-33-36-40-45-50(44-39-35-32-23-20-16-12-8-2)52(47-41-46-51(5)6)48-49(42-37-18-14-10-4)43-38-34-21-17-13-9-3/h8,22,24,26-27,49-50H,2,7,9-21,23,25,28-48H2,1,3-6H3/b24-22-,27-26- |
| InChIKey | AMZCRQLGVQTZKO-FJXGVQHMSA-N |
| XLogP | 16.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.35 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|