C29H57N — CID 87170077
(18E,21E)-N,N-dimethylheptacosa-18,21-dien-10-amine (PubChem CID 87170077) has the molecular formula C29H57N and a molecular weight of 419.78 g/mol. Its IUPAC name is (18E,21E)-N,N-dimethylheptacosa-18,21-dien-10-amine.
| Compound Name | (18E,21E)-N,N-dimethylheptacosa-18,21-dien-10-amine |
|---|---|
| PubChem CID | 87170077 |
| Molecular Formula | C29H57N |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.45 |
| IUPAC Name | (18E,21E)-N,N-dimethylheptacosa-18,21-dien-10-amine |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(CCCCCCCCC)N(C)C |
| InChI | InChI=1S/C29H57N/c1-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-28-29(30(3)4)27-25-23-21-12-10-8-6-2/h13-14,16-17,29H,5-12,15,18-28H2,1-4H3/b14-13+,17-16+ |
| InChIKey | FFEFKDZFCYQVMR-VLDVYECUSA-N |
| XLogP | 9.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|