C56H103N — CID 134205277
(6Z,9Z,28Z,31Z)-N-methyl-N-[(9Z,12Z)-octadeca-9,12-dienyl]heptatriaconta-6,9,28,31-tetraen-19-amine (PubChem CID 134205277) has the molecular formula C56H103N and a molecular weight of 790.45 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-N-methyl-N-[(9Z,12Z)-octadeca-9,12-dienyl]heptatriaconta-6,9,28,31-tetraen-19-amine.
| Compound Name | (6Z,9Z,28Z,31Z)-N-methyl-N-[(9Z,12Z)-octadeca-9,12-dienyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
|---|---|
| PubChem CID | 134205277 |
| Molecular Formula | C56H103N |
| Molecular Weight | 790.45 g/mol |
| Exact Mass | 789.81 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-N-methyl-N-[(9Z,12Z)-octadeca-9,12-dienyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(C)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C56H103N/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-53-56(54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2)57(4)55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3/h17-22,26-31,56H,5-16,23-25,32-55H2,1-4H3/b20-17-,21-18-,22-19-,29-26-,30-27-,31-28- |
| InChIKey | OPOWQXUCFRLNAW-IXQWNJBLSA-N |
| XLogP | 19.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.45 |
| LogP ≤ 5 | 19.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|