C32H63N — CID 56944347
(20Z,23Z)-N-ethyl-N-methylnonacosa-20,23-dien-10-amine (PubChem CID 56944347) has the molecular formula C32H63N and a molecular weight of 461.86 g/mol. Its IUPAC name is (20Z,23Z)-N-ethyl-N-methylnonacosa-20,23-dien-10-amine.
| Compound Name | (20Z,23Z)-N-ethyl-N-methylnonacosa-20,23-dien-10-amine |
|---|---|
| PubChem CID | 56944347 |
| Molecular Formula | C32H63N |
| Molecular Weight | 461.86 g/mol |
| Exact Mass | 461.50 |
| IUPAC Name | (20Z,23Z)-N-ethyl-N-methylnonacosa-20,23-dien-10-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC)N(C)CC |
| InChI | InChI=1S/C32H63N/c1-5-8-10-12-14-15-16-17-18-19-20-21-22-23-25-27-29-31-32(33(4)7-3)30-28-26-24-13-11-9-6-2/h14-15,17-18,32H,5-13,16,19-31H2,1-4H3/b15-14-,18-17- |
| InChIKey | IHKVCZISZBWDEJ-NFYLBXPESA-N |
| XLogP | 11.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.86 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|