C23H45N — CID 56944147
(12Z,15Z)-N,N-dimethylhenicosa-12,15-dien-4-amine (PubChem CID 56944147) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is (12Z,15Z)-N,N-dimethylhenicosa-12,15-dien-4-amine.
| Compound Name | (12Z,15Z)-N,N-dimethylhenicosa-12,15-dien-4-amine |
|---|---|
| PubChem CID | 56944147 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | (12Z,15Z)-N,N-dimethylhenicosa-12,15-dien-4-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCC)N(C)C |
| InChI | InChI=1S/C23H45N/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-23(21-6-2)24(3)4/h10-11,13-14,23H,5-9,12,15-22H2,1-4H3/b11-10-,14-13- |
| InChIKey | DFLGHUGIWAYXFV-XVTLYKPTSA-N |
| XLogP | 7.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|