C42H80N2O — CID 139508918
N,N-dimethyl-N'-[(9Z,12Z)-octadeca-9,12-dienoxy]-N'-[(9Z,12Z)-octadeca-9,12-dienyl]butane-1,4-diamine (PubChem CID 139508918) has the molecular formula C42H80N2O and a molecular weight of 629.12 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(9Z,12Z)-octadeca-9,12-dienoxy]-N'-[(9Z,12Z)-octadeca-9,12-dienyl]butane-1,4-diamine.
| Compound Name | N,N-dimethyl-N'-[(9Z,12Z)-octadeca-9,12-dienoxy]-N'-[(9Z,12Z)-octadeca-9,12-dienyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 139508918 |
| Molecular Formula | C42H80N2O |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.63 |
| IUPAC Name | N,N-dimethyl-N'-[(9Z,12Z)-octadeca-9,12-dienoxy]-N'-[(9Z,12Z)-octadeca-9,12-dienyl]butane-1,4-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCON(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCN(C)C |
| InChI | InChI=1S/C42H80N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-44(41-37-36-39-43(3)4)45-42-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | ICPXYZBYAQSPIR-KWXKLSQISA-N |
| XLogP | 13.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|