C29H45ClN2O2 — CID 11562216
4-hydroxy-N-[(5Z,8Z,11Z,14Z)-16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]benzamide;hydrochloride (PubChem CID 11562216) has the molecular formula C29H45ClN2O2 and a molecular weight of 489.14 g/mol. Its IUPAC name is 4-hydroxy-N-[(5Z,8Z,11Z,14Z)-16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]benzamide;hydrochloride.
| Compound Name | 4-hydroxy-N-[(5Z,8Z,11Z,14Z)-16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 11562216 |
| Molecular Formula | C29H45ClN2O2 |
| Molecular Weight | 489.14 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 4-hydroxy-N-[(5Z,8Z,11Z,14Z)-16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]benzamide;hydrochloride |
| SMILES | CCCCCN(C)C/C=C\C/C=C\C/C=C\C/C=C\CCCCNC(=O)c1ccc(O)cc1.Cl |
| InChI | InChI=1S/C29H44N2O2.ClH/c1-3-4-18-25-31(2)26-19-16-14-12-10-8-6-5-7-9-11-13-15-17-24-30-29(33)27-20-22-28(32)23-21-27;/h5-6,9-12,16,19-23,32H,3-4,7-8,13-15,17-18,24-26H2,1-2H3,(H,30,33);1H/b6-5-,11-9-,12-10-,19-16-; |
| InChIKey | QTXCWMSJDHEERL-AZXKPHFGSA-N |
| XLogP | 7.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.14 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|